About 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene
1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene (PubChem CID 20327) has the molecular formula C20H23Cl3O2
and a molecular weight of 401.76 g/mol. Its IUPAC name is 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene.
Molecular Properties
| Compound Name | 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene |
| PubChem CID | 20327 |
| Molecular Formula | C20H23Cl3O2 |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene |
| SMILES | CCCOc1ccc(C(c2ccc(OCCC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H23Cl3O2/c1-3-13-24-17-9-5-15(6-10-17)19(20(21,22)23)16-7-11-18(12-8-16)25-14-4-2/h5-12,19H,3-4,13-14H2,1-2H3 |
| InChIKey | MXJPGMXPKMPPGD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene?
The IUPAC name of 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene (CID 20327) is 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene.
What is the SMILES notation for 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene?
The canonical SMILES for 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene is CCCOc1ccc(C(c2ccc(OCCC)cc2)C(Cl)(Cl)Cl)cc1.
What is the InChIKey of 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene?
The InChIKey is MXJPGMXPKMPPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23Cl3O2/c1-3-13-24-17-9-5-15(6-10-17)19(20(21,22)23)16-7-11-18(12-8-16)25-14-4-2/h5-12,19H,3-4,13-14H2,1-2H3.
What are the key properties of 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene?
1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene has a molecular weight of 401.76 g/mol, XLogP of 6.77, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene is sourced from PubChem (CID 20327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).