C20H29N3O5S — CID 2032913
tert-butyl N-[5-[5-[(4-methylphenyl)methylsulfonyl]-1,3,4-oxadiazol-2-yl]pentyl]carbamate (PubChem CID 2032913) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is tert-butyl N-[5-[5-[(4-methylphenyl)methylsulfonyl]-1,3,4-oxadiazol-2-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-[(4-methylphenyl)methylsulfonyl]-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 2032913 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | tert-butyl N-[5-[5-[(4-methylphenyl)methylsulfonyl]-1,3,4-oxadiazol-2-yl]pentyl]carbamate |
| SMILES | Cc1ccc(CS(=O)(=O)c2nnc(CCCCCNC(=O)OC(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C20H29N3O5S/c1-15-9-11-16(12-10-15)14-29(25,26)19-23-22-17(27-19)8-6-5-7-13-21-18(24)28-20(2,3)4/h9-12H,5-8,13-14H2,1-4H3,(H,21,24) |
| InChIKey | TVUSVAAWHISCRJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|