About (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate
(5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate (PubChem CID 20329930) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate.
Molecular Properties
| Compound Name | (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate |
| PubChem CID | 20329930 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate |
| SMILES | CC1CCC(C(C1)OC(=O)OC(=C)C)C(C)C |
| InChI | InChI=1S/C14H24O3/c1-9(2)12-7-6-11(5)8-13(12)17-14(15)16-10(3)4/h9,11-13H,3,6-8H2,1-2,4-5H3 |
| InChIKey | ANPOVRCDYYOXCK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | 283 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate?
The IUPAC name of (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate (CID 20329930) is (5-methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate.
What is the SMILES notation for (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate?
The canonical SMILES for (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate is CC1CCC(C(C1)OC(=O)OC(=C)C)C(C)C.
What is the InChIKey of (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate?
The InChIKey is ANPOVRCDYYOXCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-9(2)12-7-6-11(5)8-13(12)17-14(15)16-10(3)4/h9,11-13H,3,6-8H2,1-2,4-5H3.
What are the key properties of (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate?
(5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate has a molecular weight of 240.34 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-Methyl-2-propan-2-ylcyclohexyl) prop-1-en-2-yl carbonate is sourced from PubChem (CID 20329930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).