C11H23N3O2 — CID 20336852
N,N'-((Methylazanediyl)bis(propane-3,1-diyl))diacetamide (PubChem CID 20336852) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[3-[3-acetamidopropyl(methyl)amino]propyl]acetamide.
| Compound Name | N,N'-((Methylazanediyl)bis(propane-3,1-diyl))diacetamide |
|---|---|
| PubChem CID | 20336852 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[3-[3-acetamidopropyl(methyl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCN(C)CCCNC(=O)C |
| InChI | InChI=1S/C11H23N3O2/c1-10(15)12-6-4-8-14(3)9-5-7-13-11(2)16/h4-9H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | LBXNUASZYCUIPL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | 197 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|