C22H19FN4O — CID 2033781
(6S,8aR,9S)-9-(2-fluorophenyl)-6-(2-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2033781) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is (6S,8aR,9S)-9-(2-fluorophenyl)-6-(2-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6S,8aR,9S)-9-(2-fluorophenyl)-6-(2-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2033781 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (6S,8aR,9S)-9-(2-fluorophenyl)-6-(2-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccccc1[C@@H]1C=C2Nc3ncnn3[C@H](c3ccccc3F)[C@H]2C(=O)C1 |
| InChI | InChI=1S/C22H19FN4O/c1-13-6-2-3-7-15(13)14-10-18-20(19(28)11-14)21(16-8-4-5-9-17(16)23)27-22(26-18)24-12-25-27/h2-10,12,14,20-21H,11H2,1H3,(H,24,25,26)/t14-,20-,21-/m1/s1 |
| InChIKey | BPQVTMHTKVZNMT-XMDBHEJHSA-N |
| XLogP | 4.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |