About 7-Ethylpyrido[1,2-a]pyrimidin-4-one
7-Ethylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 20348008) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 7-ethylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-Ethylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 20348008 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 7-ethylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCC1=CN2C(=NC=CC2=O)C=C1 |
| InChI | InChI=1S/C10H10N2O/c1-2-8-3-4-9-11-6-5-10(13)12(9)7-8/h3-7H,2H2,1H3 |
| InChIKey | QPNYRVVTEGXFDL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 361 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-Ethylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-Ethylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-Ethylpyrido[1,2-a]pyrimidin-4-one (CID 20348008) is 7-ethylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-Ethylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-Ethylpyrido[1,2-a]pyrimidin-4-one is CCC1=CN2C(=NC=CC2=O)C=C1.
What is the InChIKey of 7-Ethylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is QPNYRVVTEGXFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-2-8-3-4-9-11-6-5-10(13)12(9)7-8/h3-7H,2H2,1H3.
What are the key properties of 7-Ethylpyrido[1,2-a]pyrimidin-4-one?
7-Ethylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 174.20 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-Ethylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 20348008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).