C16H14N6O4S3 — CID 2035178
N-[[4-[(4-methoxy-1,2,5-thiadiazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 2035178) has the molecular formula C16H14N6O4S3 and a molecular weight of 450.53 g/mol. Its IUPAC name is N-[[4-[(4-methoxy-1,2,5-thiadiazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(4-methoxy-1,2,5-thiadiazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2035178 |
| Molecular Formula | C16H14N6O4S3 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | N-[[4-[(4-methoxy-1,2,5-thiadiazol-3-yl)sulfamoyl]phenyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | COc1nsnc1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C16H14N6O4S3/c1-26-15-13(20-28-21-15)22-29(24,25)12-6-4-11(5-7-12)18-16(27)19-14(23)10-3-2-8-17-9-10/h2-9H,1H3,(H,20,22)(H2,18,19,23,27) |
| InChIKey | CVXZZNKCWANTLD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|