About 4-butoxyaniline
4-butoxyaniline (PubChem CID 20352) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-butoxyaniline.
Molecular Properties
| Compound Name | 4-butoxyaniline |
| PubChem CID | 20352 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-butoxyaniline |
| SMILES | CCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C10H15NO/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-7H,2-3,8,11H2,1H3 |
| InChIKey | UBRIHZOFEJHMIT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxyaniline?
The IUPAC name of 4-butoxyaniline (CID 20352) is 4-butoxyaniline.
What is the SMILES notation for 4-butoxyaniline?
The canonical SMILES for 4-butoxyaniline is CCCCOc1ccc(N)cc1.
What is the InChIKey of 4-butoxyaniline?
The InChIKey is UBRIHZOFEJHMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-7H,2-3,8,11H2,1H3.
What are the key properties of 4-butoxyaniline?
4-butoxyaniline has a molecular weight of 165.24 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxyaniline is sourced from PubChem (CID 20352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).