About 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine
5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 2036160) has the molecular formula C22H20Cl2N4
and a molecular weight of 411.34 g/mol. Its IUPAC name is 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 2036160 |
| Molecular Formula | C22H20Cl2N4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)(C)c1cc(Nc2ccc(Cl)c(Cl)c2)n2ncc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H20Cl2N4/c1-22(2,3)19-12-20(26-15-9-10-17(23)18(24)11-15)28-21(27-19)16(13-25-28)14-7-5-4-6-8-14/h4-13,26H,1-3H3 |
| InChIKey | RMFPNDNDVSNQSI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine (CID 2036160) is 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine is CC(C)(C)c1cc(Nc2ccc(Cl)c(Cl)c2)n2ncc(-c3ccccc3)c2n1.
What is the InChIKey of 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is RMFPNDNDVSNQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N4/c1-22(2,3)19-12-20(26-15-9-10-17(23)18(24)11-15)28-21(27-19)16(13-25-28)14-7-5-4-6-8-14/h4-13,26H,1-3H3.
What are the key properties of 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 411.34 g/mol, XLogP of 6.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-(3,4-dichlorophenyl)-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 2036160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).