C18H16N2O3 — CID 2036190
(4S,4aS,7R)-4-(furan-2-yl)-7-phenyl-1,3,4,4a,6,7-hexahydroquinazoline-2,5-dione (PubChem CID 2036190) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (4S,4aS,7R)-4-(furan-2-yl)-7-phenyl-1,3,4,4a,6,7-hexahydroquinazoline-2,5-dione.
| Compound Name | (4S,4aS,7R)-4-(furan-2-yl)-7-phenyl-1,3,4,4a,6,7-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 2036190 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (4S,4aS,7R)-4-(furan-2-yl)-7-phenyl-1,3,4,4a,6,7-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C[C@H](c3ccccc3)CC(=O)[C@H]2[C@@H](c2ccco2)N1 |
| InChI | InChI=1S/C18H16N2O3/c21-14-10-12(11-5-2-1-3-6-11)9-13-16(14)17(20-18(22)19-13)15-7-4-8-23-15/h1-9,12,16-17H,10H2,(H2,19,20,22)/t12-,16-,17+/m0/s1 |
| InChIKey | XGFAZNJZSDWADB-AFAVFJNCSA-N |
| XLogP | 2.89 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |