C27H32BrNO — CID 2037137
(1S)-1-(2-bromophenyl)-1-phenyl-5-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol (PubChem CID 2037137) has the molecular formula C27H32BrNO and a molecular weight of 466.46 g/mol. Its IUPAC name is (1S)-1-(2-bromophenyl)-1-phenyl-5-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol.
| Compound Name | (1S)-1-(2-bromophenyl)-1-phenyl-5-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol |
|---|---|
| PubChem CID | 2037137 |
| Molecular Formula | C27H32BrNO |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (1S)-1-(2-bromophenyl)-1-phenyl-5-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2CC#CC[C@](O)(c2ccccc2)c2ccccc2Br)C1 |
| InChI | InChI=1S/C27H32BrNO/c1-25(2)17-22-18-26(3,19-25)20-29(22)16-10-9-15-27(30,21-11-5-4-6-12-21)23-13-7-8-14-24(23)28/h4-8,11-14,22,30H,15-20H2,1-3H3/t22-,26-,27-/m0/s1 |
| InChIKey | PBIQFUZKYRBPQF-CAVYSCNFSA-N |
| XLogP | 5.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|