C20H22N2O3S — CID 2038131
2-ethylsulfanyl-6,7-dimethoxy-3-(2-phenylethyl)quinazolin-4-one (PubChem CID 2038131) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-ethylsulfanyl-6,7-dimethoxy-3-(2-phenylethyl)quinazolin-4-one.
| Compound Name | 2-ethylsulfanyl-6,7-dimethoxy-3-(2-phenylethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2038131 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-ethylsulfanyl-6,7-dimethoxy-3-(2-phenylethyl)quinazolin-4-one |
| SMILES | CCSc1nc2cc(OC)c(OC)cc2c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-4-26-20-21-16-13-18(25-3)17(24-2)12-15(16)19(23)22(20)11-10-14-8-6-5-7-9-14/h5-9,12-13H,4,10-11H2,1-3H3 |
| InChIKey | WKSCMROPLCMKCL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |