C15H18Cl2N5S2+ — CID 2038674
5-[6-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]pentylazanium (PubChem CID 2038674) has the molecular formula C15H18Cl2N5S2+ and a molecular weight of 403.38 g/mol. Its IUPAC name is 5-[6-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]pentylazanium.
| Compound Name | 5-[6-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]pentylazanium |
|---|---|
| PubChem CID | 2038674 |
| Molecular Formula | C15H18Cl2N5S2+ |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 5-[6-[(2,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]pentylazanium |
| SMILES | [NH3+]CCCCCc1nnc2sc(SCc3ccc(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C15H17Cl2N5S2/c16-11-6-5-10(12(17)8-11)9-23-15-21-22-13(4-2-1-3-7-18)19-20-14(22)24-15/h5-6,8H,1-4,7,9,18H2/p+1 |
| InChIKey | JFTVMHPLYKPEDU-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|