About (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol
(2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol (PubChem CID 20397) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol.
Molecular Properties
| Compound Name | (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol |
| PubChem CID | 20397 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCCC1(c2ccccc2)OCC(CO)O1 |
| InChI | InChI=1S/C13H18O3/c1-2-8-13(11-6-4-3-5-7-11)15-10-12(9-14)16-13/h3-7,12,14H,2,8-10H2,1H3 |
| InChIKey | WTRULDHVZHPDHC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol?
The IUPAC name of (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol (CID 20397) is (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol.
What is the SMILES notation for (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol?
The canonical SMILES for (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol is CCCC1(c2ccccc2)OCC(CO)O1.
What is the InChIKey of (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol?
The InChIKey is WTRULDHVZHPDHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-2-8-13(11-6-4-3-5-7-11)15-10-12(9-14)16-13/h3-7,12,14H,2,8-10H2,1H3.
What are the key properties of (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol?
(2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol has a molecular weight of 222.28 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-2-propyl-1,3-dioxolan-4-yl)methanol is sourced from PubChem (CID 20397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).