About 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine
4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine (PubChem CID 2040715) has the molecular formula C19H22ClN3S
and a molecular weight of 359.93 g/mol. Its IUPAC name is 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine |
| PubChem CID | 2040715 |
| Molecular Formula | C19H22ClN3S |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine |
| SMILES | Cc1c(-c2csc(NC3CCCCC3)n2)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C19H22ClN3S/c1-12-18(15-10-13(20)8-9-17(15)23(12)2)16-11-24-19(22-16)21-14-6-4-3-5-7-14/h8-11,14H,3-7H2,1-2H3,(H,21,22) |
| InChIKey | JPJVUISGUUEXFV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine?
The IUPAC name of 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine (CID 2040715) is 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine is Cc1c(-c2csc(NC3CCCCC3)n2)c2cc(Cl)ccc2n1C.
What is the InChIKey of 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine?
The InChIKey is JPJVUISGUUEXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN3S/c1-12-18(15-10-13(20)8-9-17(15)23(12)2)16-11-24-19(22-16)21-14-6-4-3-5-7-14/h8-11,14H,3-7H2,1-2H3,(H,21,22).
What are the key properties of 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine?
4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine has a molecular weight of 359.93 g/mol, XLogP of 6.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-1,2-dimethylindol-3-yl)-N-cyclohexyl-1,3-thiazol-2-amine is sourced from PubChem (CID 2040715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).