C17H18N4O6-2 — CID 2041012
(2S)-2-[[(2S)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanoyl]amino]pentanedioate (PubChem CID 2041012) has the molecular formula C17H18N4O6-2 and a molecular weight of 374.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanoyl]amino]pentanedioate.
| Compound Name | (2S)-2-[[(2S)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 2041012 |
| Molecular Formula | C17H18N4O6-2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (2S)-2-[[(2S)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)butanoyl]amino]pentanedioate |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H20N4O6/c1-9(2)14(15(24)18-12(17(26)27)7-8-13(22)23)21-16(25)10-5-3-4-6-11(10)19-20-21/h3-6,9,12,14H,7-8H2,1-2H3,(H,18,24)(H,22,23)(H,26,27)/p-2/t12-,14-/m0/s1 |
| InChIKey | ZHHACFJLJHWRSJ-JSGCOSHPSA-L |
| XLogP | -2.25 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |