C20H22N2O2S2 — CID 2042385
1-[2-(2-hydroxyethoxy)ethyl]-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-4-thione (PubChem CID 2042385) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-4-thione.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 2042385 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-4-thione |
| SMILES | OCCOCCn1c(-c2ccccc2)nc(=S)c2c3c(sc21)CCCC3 |
| InChI | InChI=1S/C20H22N2O2S2/c23-11-13-24-12-10-22-18(14-6-2-1-3-7-14)21-19(25)17-15-8-4-5-9-16(15)26-20(17)22/h1-3,6-7,23H,4-5,8-13H2 |
| InChIKey | JURFWWNQRGSSAF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|