C21H20N4O4S — CID 2042400
N-(1,3-benzodioxol-5-yl)-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2042400) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2042400 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc3c(c2)OCO3)nnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C21H20N4O4S/c1-3-9-25-20(14-5-4-6-16(10-14)27-2)23-24-21(25)30-12-19(26)22-15-7-8-17-18(11-15)29-13-28-17/h3-8,10-11H,1,9,12-13H2,2H3,(H,22,26) |
| InChIKey | PXRYDXBXMYQAEN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|