C14H26O — CID 20437273
4,4,5,6a-tetramethyl-3-propyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan (PubChem CID 20437273) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 4,4,5,6a-tetramethyl-3-propyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan.
| Compound Name | 4,4,5,6a-tetramethyl-3-propyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
|---|---|
| PubChem CID | 20437273 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 4,4,5,6a-tetramethyl-3-propyl-3,3a,5,6-tetrahydro-1H-cyclopenta[c]furan |
| SMILES | CCCC1C2C(C(CC2(CO1)C)C)(C)C |
| InChI | InChI=1S/C14H26O/c1-6-7-11-12-13(3,4)10(2)8-14(12,5)9-15-11/h10-12H,6-9H2,1-5H3 |
| InChIKey | KFCMTFALFJFCAW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 246 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |