About 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine
1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine (PubChem CID 2045522) has the molecular formula C19H14Cl2N4S
and a molecular weight of 401.32 g/mol. Its IUPAC name is 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 2045522 |
| Molecular Formula | C19H14Cl2N4S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine |
| SMILES | Clc1cccc(Cl)c1CSc1ncnc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N4S/c20-16-7-4-8-17(21)15(16)11-26-19-14-9-24-25(18(14)22-12-23-19)10-13-5-2-1-3-6-13/h1-9,12H,10-11H2 |
| InChIKey | KQEAMBXTRMFPBQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine (CID 2045522) is 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine is Clc1cccc(Cl)c1CSc1ncnc2c1cnn2Cc1ccccc1.
What is the InChIKey of 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine?
The InChIKey is KQEAMBXTRMFPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N4S/c20-16-7-4-8-17(21)15(16)11-26-19-14-9-24-25(18(14)22-12-23-19)10-13-5-2-1-3-6-13/h1-9,12H,10-11H2.
What are the key properties of 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine?
1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine has a molecular weight of 401.32 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[(2,6-dichlorophenyl)methylsulfanyl]pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 2045522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).