C19H18F3N3O4 — CID 2046580
N-[2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 2046580) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2046580 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[2-[2-[(2,3-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | COc1cccc(C=NNC(=O)CNC(=O)c2ccccc2C(F)(F)F)c1OC |
| InChI | InChI=1S/C19H18F3N3O4/c1-28-15-9-5-6-12(17(15)29-2)10-24-25-16(26)11-23-18(27)13-7-3-4-8-14(13)19(20,21)22/h3-10H,11H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | XFSOGPGVMZWYDV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|