About Alprenolol, (S)-
Alprenolol, (S)- (PubChem CID 204665) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is (2S)-1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol.
Molecular Properties
| Compound Name | Alprenolol, (S)- |
| PubChem CID | 204665 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2S)-1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | CC(C)NC[C@@H](COC1=CC=CC=C1CC=C)O |
| InChI | InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3/t14-/m0/s1 |
| InChIKey | PAZJSJFMUHDSTF-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 41.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | 231 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Alprenolol, (S)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Alprenolol, (S)-?
The IUPAC name of Alprenolol, (S)- (CID 204665) is (2S)-1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol.
What is the SMILES notation for Alprenolol, (S)-?
The canonical SMILES for Alprenolol, (S)- is CC(C)NC[C@@H](COC1=CC=CC=C1CC=C)O.
What is the InChIKey of Alprenolol, (S)-?
The InChIKey is PAZJSJFMUHDSTF-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3/t14-/m0/s1.
What are the key properties of Alprenolol, (S)-?
Alprenolol, (S)- has a molecular weight of 249.35 g/mol, XLogP of 3.10, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Alprenolol, (S)- is sourced from PubChem (CID 204665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).