About 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one
5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 2047201) has the molecular formula C23H14BrFN4O
and a molecular weight of 461.29 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 2047201 |
| Molecular Formula | C23H14BrFN4O |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccccc3)c2nc(-c2ccccc2F)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H14BrFN4O/c24-15-10-12-16(13-11-15)28-21(18-8-4-5-9-20(18)25)27-22-19(23(28)30)14-26-29(22)17-6-2-1-3-7-17/h1-14H |
| InChIKey | AENVNGDHIIEYHT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (CID 2047201) is 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one is O=c1c2cnn(-c3ccccc3)c2nc(-c2ccccc2F)n1-c1ccc(Br)cc1.
What is the InChIKey of 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is AENVNGDHIIEYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14BrFN4O/c24-15-10-12-16(13-11-15)28-21(18-8-4-5-9-20(18)25)27-22-19(23(28)30)14-26-29(22)17-6-2-1-3-7-17/h1-14H.
What are the key properties of 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one?
5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 461.29 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-6-(2-fluorophenyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 2047201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).