C11H20N2 — CID 20476288
1,4-Diethyl-2-methylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 20476288) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,4-diethyl-2-methylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1,4-Diethyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 20476288 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,4-diethyl-2-methylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | CCC1=C(C(C(C=C1)(CC)N)C)N |
| InChI | InChI=1S/C11H20N2/c1-4-9-6-7-11(13,5-2)8(3)10(9)12/h6-8H,4-5,12-13H2,1-3H3 |
| InChIKey | DKCAWSVQJGQJBJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 253 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |