C14H20N2O2S3 — CID 2047727
ethyl 5,5-dimethyl-2-(methylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]thiopyran-3-carboxylate (PubChem CID 2047727) has the molecular formula C14H20N2O2S3 and a molecular weight of 344.53 g/mol. Its IUPAC name is ethyl 5,5-dimethyl-2-(methylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]thiopyran-3-carboxylate.
| Compound Name | ethyl 5,5-dimethyl-2-(methylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 2047727 |
| Molecular Formula | C14H20N2O2S3 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | ethyl 5,5-dimethyl-2-(methylcarbamothioylamino)-4,7-dihydrothieno[2,3-c]thiopyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC)sc2c1CC(C)(C)SC2 |
| InChI | InChI=1S/C14H20N2O2S3/c1-5-18-12(17)10-8-6-14(2,3)20-7-9(8)21-11(10)16-13(19)15-4/h5-7H2,1-4H3,(H2,15,16,19) |
| InChIKey | YWIMYFYWSDNJCY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|