About 1,2,2-triphenylethanol
1,2,2-triphenylethanol (PubChem CID 20482) has the molecular formula C20H18O
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1,2,2-triphenylethanol.
Molecular Properties
| Compound Name | 1,2,2-triphenylethanol |
| PubChem CID | 20482 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,2,2-triphenylethanol |
| SMILES | OC(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19-21H |
| InChIKey | VNQNLCDOGBOKPL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,2-triphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-triphenylethanol?
The IUPAC name of 1,2,2-triphenylethanol (CID 20482) is 1,2,2-triphenylethanol.
What is the SMILES notation for 1,2,2-triphenylethanol?
The canonical SMILES for 1,2,2-triphenylethanol is OC(c1ccccc1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2,2-triphenylethanol?
The InChIKey is VNQNLCDOGBOKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19-21H.
What are the key properties of 1,2,2-triphenylethanol?
1,2,2-triphenylethanol has a molecular weight of 274.36 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-triphenylethanol is sourced from PubChem (CID 20482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).