About 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol
3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol (PubChem CID 2048402) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol |
| PubChem CID | 2048402 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol |
| SMILES | COc1ccc(CNCCCO)cc1OC |
| InChI | InChI=1S/C12H19NO3/c1-15-11-5-4-10(8-12(11)16-2)9-13-6-3-7-14/h4-5,8,13-14H,3,6-7,9H2,1-2H3 |
| InChIKey | HIKXKHNWFNPXLJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol?
The IUPAC name of 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol (CID 2048402) is 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol.
What is the SMILES notation for 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol?
The canonical SMILES for 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol is COc1ccc(CNCCCO)cc1OC.
What is the InChIKey of 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol?
The InChIKey is HIKXKHNWFNPXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-15-11-5-4-10(8-12(11)16-2)9-13-6-3-7-14/h4-5,8,13-14H,3,6-7,9H2,1-2H3.
What are the key properties of 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol?
3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol has a molecular weight of 225.29 g/mol, XLogP of 1.18, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethoxyphenyl)methylamino]propan-1-ol is sourced from PubChem (CID 2048402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).