C21H17ClN4OS — CID 2048670
(4R,4aS)-2-(1,3-benzothiazol-2-ylamino)-4-(2-chlorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-5-one (PubChem CID 2048670) has the molecular formula C21H17ClN4OS and a molecular weight of 408.91 g/mol. Its IUPAC name is (4R,4aS)-2-(1,3-benzothiazol-2-ylamino)-4-(2-chlorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-5-one.
| Compound Name | (4R,4aS)-2-(1,3-benzothiazol-2-ylamino)-4-(2-chlorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 2048670 |
| Molecular Formula | C21H17ClN4OS |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (4R,4aS)-2-(1,3-benzothiazol-2-ylamino)-4-(2-chlorophenyl)-4,4a,6,7-tetrahydro-1H-quinazolin-5-one |
| SMILES | O=C1CCC=C2NC(Nc3nc4ccccc4s3)=N[C@@H](c3ccccc3Cl)[C@H]12 |
| InChI | InChI=1S/C21H17ClN4OS/c22-13-7-2-1-6-12(13)19-18-15(9-5-10-16(18)27)23-20(25-19)26-21-24-14-8-3-4-11-17(14)28-21/h1-4,6-9,11,18-19H,5,10H2,(H2,23,24,25,26)/t18-,19-/m0/s1 |
| InChIKey | QKDAPUXIPXNAPK-OALUTQOASA-N |
| XLogP | 4.93 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |