C10H15NO4S4 — CID 2048699
[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl] N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate (PubChem CID 2048699) has the molecular formula C10H15NO4S4 and a molecular weight of 341.50 g/mol. Its IUPAC name is [(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl] N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate.
| Compound Name | [(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl] N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 2048699 |
| Molecular Formula | C10H15NO4S4 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | [(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl] N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
| SMILES | CN(C(=S)S[C@H]1C=CS(=O)(=O)C1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15NO4S4/c1-11(8-2-4-18(12,13)6-8)10(16)17-9-3-5-19(14,15)7-9/h3,5,8-9H,2,4,6-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | HYXGXPXNFWQTCK-BDAKNGLRSA-N |
| XLogP | 0.43 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|