C11H11N3S — CID 2049317
2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine (PubChem CID 2049317) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine.
| Compound Name | 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 2049317 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine |
| SMILES | Nc1c2c(nn1-c1ccccc1)CSC2 |
| InChI | InChI=1S/C11H11N3S/c12-11-9-6-15-7-10(9)13-14(11)8-4-2-1-3-5-8/h1-5H,6-7,12H2 |
| InChIKey | PVKVTEYRFBNYMQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |