About butane-1,2,3-triol
butane-1,2,3-triol (PubChem CID 20497) has the molecular formula C4H10O3
and a molecular weight of 106.12 g/mol. Its IUPAC name is butane-1,2,3-triol.
Molecular Properties
| Compound Name | butane-1,2,3-triol |
| PubChem CID | 20497 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | butane-1,2,3-triol |
| SMILES | CC(O)C(O)CO |
| InChI | InChI=1S/C4H10O3/c1-3(6)4(7)2-5/h3-7H,2H2,1H3 |
| InChIKey | YAXKTBLXMTYWDQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,2,3-triol?
The IUPAC name of butane-1,2,3-triol (CID 20497) is butane-1,2,3-triol.
What is the SMILES notation for butane-1,2,3-triol?
The canonical SMILES for butane-1,2,3-triol is CC(O)C(O)CO.
What is the InChIKey of butane-1,2,3-triol?
The InChIKey is YAXKTBLXMTYWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3/c1-3(6)4(7)2-5/h3-7H,2H2,1H3.
What are the key properties of butane-1,2,3-triol?
butane-1,2,3-triol has a molecular weight of 106.12 g/mol, XLogP of -1.28, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,2,3-triol is sourced from PubChem (CID 20497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).