C9H7NO2S — CID 2049771
(4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 2049771) has the molecular formula C9H7NO2S and a molecular weight of 193.23 g/mol. Its IUPAC name is (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2049771 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CC1=N/C(=C\c2cccs2)C(=O)O1 |
| InChI | InChI=1S/C9H7NO2S/c1-6-10-8(9(11)12-6)5-7-3-2-4-13-7/h2-5H,1H3/b8-5- |
| InChIKey | FNIJNQKPASQIFL-YVMONPNESA-N |
| XLogP | 2.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|