About 6-fluoro-3-methyl-1,3-benzothiazol-2-imine
6-fluoro-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 2049829) has the molecular formula C8H7FN2S
and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-fluoro-3-methyl-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 6-fluoro-3-methyl-1,3-benzothiazol-2-imine |
| PubChem CID | 2049829 |
| Molecular Formula | C8H7FN2S |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 6-fluoro-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(F)ccc2n1C |
| InChI | InChI=1S/C8H7FN2S/c1-11-6-3-2-5(9)4-7(6)12-8(11)10/h2-4,10H,1H3/b10-8- |
| InChIKey | UQYULENSGICZFQ-NTMALXAHSA-N |
| XLogP | 1.86 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3-methyl-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-methyl-1,3-benzothiazol-2-imine?
The IUPAC name of 6-fluoro-3-methyl-1,3-benzothiazol-2-imine (CID 2049829) is 6-fluoro-3-methyl-1,3-benzothiazol-2-imine.
What is the SMILES notation for 6-fluoro-3-methyl-1,3-benzothiazol-2-imine?
The canonical SMILES for 6-fluoro-3-methyl-1,3-benzothiazol-2-imine is [H]/N=c1\sc2cc(F)ccc2n1C.
What is the InChIKey of 6-fluoro-3-methyl-1,3-benzothiazol-2-imine?
The InChIKey is UQYULENSGICZFQ-NTMALXAHSA-N. The full InChI is InChI=1S/C8H7FN2S/c1-11-6-3-2-5(9)4-7(6)12-8(11)10/h2-4,10H,1H3/b10-8-.
What are the key properties of 6-fluoro-3-methyl-1,3-benzothiazol-2-imine?
6-fluoro-3-methyl-1,3-benzothiazol-2-imine has a molecular weight of 182.22 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-methyl-1,3-benzothiazol-2-imine is sourced from PubChem (CID 2049829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).