About (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine
(4-ethoxy-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 2049835) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine.
Molecular Properties
| Compound Name | (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine |
| PubChem CID | 2049835 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | CCOc1cccc2sc(NN)nc12 |
| InChI | InChI=1S/C9H11N3OS/c1-2-13-6-4-3-5-7-8(6)11-9(12-10)14-7/h3-5H,2,10H2,1H3,(H,11,12) |
| InChIKey | JMUUSQSFBDDCHL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine?
The IUPAC name of (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine (CID 2049835) is (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine.
What is the SMILES notation for (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine?
The canonical SMILES for (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine is CCOc1cccc2sc(NN)nc12.
What is the InChIKey of (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine?
The InChIKey is JMUUSQSFBDDCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-2-13-6-4-3-5-7-8(6)11-9(12-10)14-7/h3-5H,2,10H2,1H3,(H,11,12).
What are the key properties of (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine?
(4-ethoxy-1,3-benzothiazol-2-yl)hydrazine has a molecular weight of 209.27 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-1,3-benzothiazol-2-yl)hydrazine is sourced from PubChem (CID 2049835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).