About (4-bromo-1,3-benzothiazol-2-yl)hydrazine
(4-bromo-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 2049838) has the molecular formula C7H6BrN3S
and a molecular weight of 244.12 g/mol. Its IUPAC name is (4-bromo-1,3-benzothiazol-2-yl)hydrazine.
Molecular Properties
| Compound Name | (4-bromo-1,3-benzothiazol-2-yl)hydrazine |
| PubChem CID | 2049838 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | (4-bromo-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | NNc1nc2c(Br)cccc2s1 |
| InChI | InChI=1S/C7H6BrN3S/c8-4-2-1-3-5-6(4)10-7(11-9)12-5/h1-3H,9H2,(H,10,11) |
| InChIKey | WBDWQZLAGDRYRD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-1,3-benzothiazol-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-1,3-benzothiazol-2-yl)hydrazine?
The IUPAC name of (4-bromo-1,3-benzothiazol-2-yl)hydrazine (CID 2049838) is (4-bromo-1,3-benzothiazol-2-yl)hydrazine.
What is the SMILES notation for (4-bromo-1,3-benzothiazol-2-yl)hydrazine?
The canonical SMILES for (4-bromo-1,3-benzothiazol-2-yl)hydrazine is NNc1nc2c(Br)cccc2s1.
What is the InChIKey of (4-bromo-1,3-benzothiazol-2-yl)hydrazine?
The InChIKey is WBDWQZLAGDRYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3S/c8-4-2-1-3-5-6(4)10-7(11-9)12-5/h1-3H,9H2,(H,10,11).
What are the key properties of (4-bromo-1,3-benzothiazol-2-yl)hydrazine?
(4-bromo-1,3-benzothiazol-2-yl)hydrazine has a molecular weight of 244.12 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-1,3-benzothiazol-2-yl)hydrazine is sourced from PubChem (CID 2049838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).