C8H6N2O2S — CID 2049900
[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine (PubChem CID 2049900) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine.
| Compound Name | [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
|---|---|
| PubChem CID | 2049900 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | [1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
| SMILES | Nc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C8H6N2O2S/c9-8-10-4-1-5-6(12-3-11-5)2-7(4)13-8/h1-2H,3H2,(H2,9,10) |
| InChIKey | GAIRHYOGMGDIGP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |