About fluoren-9-imine
fluoren-9-imine (PubChem CID 20500) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is fluoren-9-imine.
Molecular Properties
| Compound Name | fluoren-9-imine |
| PubChem CID | 20500 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | fluoren-9-imine |
| SMILES | [H]N=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H9N/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,14H |
| InChIKey | QVJLOUKVQGQPCX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze fluoren-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-9-imine?
The IUPAC name of fluoren-9-imine (CID 20500) is fluoren-9-imine.
What is the SMILES notation for fluoren-9-imine?
The canonical SMILES for fluoren-9-imine is [H]N=C1c2ccccc2-c2ccccc21.
What is the InChIKey of fluoren-9-imine?
The InChIKey is QVJLOUKVQGQPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,14H.
What are the key properties of fluoren-9-imine?
fluoren-9-imine has a molecular weight of 179.22 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-9-imine is sourced from PubChem (CID 20500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).