C22H30 — CID 20500456
2-(4-methylcyclohexyl)-6-pentylnaphthalene (PubChem CID 20500456) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-(4-methylcyclohexyl)-6-pentylnaphthalene.
| Compound Name | 2-(4-methylcyclohexyl)-6-pentylnaphthalene |
|---|---|
| PubChem CID | 20500456 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2-(4-methylcyclohexyl)-6-pentylnaphthalene |
| SMILES | CCCCCc1ccc2cc(C3CCC(C)CC3)ccc2c1 |
| InChI | InChI=1S/C22H30/c1-3-4-5-6-18-9-12-22-16-21(14-13-20(22)15-18)19-10-7-17(2)8-11-19/h9,12-17,19H,3-8,10-11H2,1-2H3 |
| InChIKey | CSMIQEYOPGDBMY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|