About cyclohexyl N-propan-2-ylcarbamate
cyclohexyl N-propan-2-ylcarbamate (PubChem CID 20500806) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is cyclohexyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | cyclohexyl N-propan-2-ylcarbamate |
| PubChem CID | 20500806 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | cyclohexyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c1-8(2)11-10(12)13-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | HJDKDBZBAJJYTJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl N-propan-2-ylcarbamate?
The IUPAC name of cyclohexyl N-propan-2-ylcarbamate (CID 20500806) is cyclohexyl N-propan-2-ylcarbamate.
What is the SMILES notation for cyclohexyl N-propan-2-ylcarbamate?
The canonical SMILES for cyclohexyl N-propan-2-ylcarbamate is CC(C)NC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl N-propan-2-ylcarbamate?
The InChIKey is HJDKDBZBAJJYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-8(2)11-10(12)13-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,11,12).
What are the key properties of cyclohexyl N-propan-2-ylcarbamate?
cyclohexyl N-propan-2-ylcarbamate has a molecular weight of 185.27 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl N-propan-2-ylcarbamate is sourced from PubChem (CID 20500806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).