C24H15Cl2N3O4 — CID 20501035
1-benzoyl-1'-[(3,4-dichlorophenyl)methyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 20501035) has the molecular formula C24H15Cl2N3O4 and a molecular weight of 480.31 g/mol. Its IUPAC name is 1-benzoyl-1'-[(3,4-dichlorophenyl)methyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1-benzoyl-1'-[(3,4-dichlorophenyl)methyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 20501035 |
| Molecular Formula | C24H15Cl2N3O4 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 1-benzoyl-1'-[(3,4-dichlorophenyl)methyl]spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(C(=O)N(Cc3ccc(Cl)c(Cl)c3)c3ccccc32)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H15Cl2N3O4/c25-17-11-10-14(12-18(17)26)13-28-19-9-5-4-8-16(19)24(22(28)32)21(31)27-23(33)29(24)20(30)15-6-2-1-3-7-15/h1-12H,13H2,(H,27,31,33) |
| InChIKey | KBTATOSXVBMNRM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|