About 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine
2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 20501051) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine |
| PubChem CID | 20501051 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CCC1(C)CC(N)CC(C)(C)N1CC=C(C)C |
| InChI | InChI=1S/C15H30N2/c1-7-15(6)11-13(16)10-14(4,5)17(15)9-8-12(2)3/h8,13H,7,9-11,16H2,1-6H3 |
| InChIKey | KXVHEFLPWAIPQJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine?
The IUPAC name of 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine (CID 20501051) is 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine.
What is the SMILES notation for 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine?
The canonical SMILES for 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine is CCC1(C)CC(N)CC(C)(C)N1CC=C(C)C.
What is the InChIKey of 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine?
The InChIKey is KXVHEFLPWAIPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-7-15(6)11-13(16)10-14(4,5)17(15)9-8-12(2)3/h8,13H,7,9-11,16H2,1-6H3.
What are the key properties of 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine?
2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine has a molecular weight of 238.42 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6,6-trimethyl-1-(3-methylbut-2-enyl)piperidin-4-amine is sourced from PubChem (CID 20501051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).