About 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol
2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol (PubChem CID 20501070) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol |
| PubChem CID | 20501070 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol |
| SMILES | CCC1(CC)CC(O)CC(C)(C)N1CC=C(C)C |
| InChI | InChI=1S/C16H31NO/c1-7-16(8-2)12-14(18)11-15(5,6)17(16)10-9-13(3)4/h9,14,18H,7-8,10-12H2,1-6H3 |
| InChIKey | RBSAFQIVPCHDRJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol?
The IUPAC name of 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol (CID 20501070) is 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol.
What is the SMILES notation for 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol?
The canonical SMILES for 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol is CCC1(CC)CC(O)CC(C)(C)N1CC=C(C)C.
What is the InChIKey of 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol?
The InChIKey is RBSAFQIVPCHDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-7-16(8-2)12-14(18)11-15(5,6)17(16)10-9-13(3)4/h9,14,18H,7-8,10-12H2,1-6H3.
What are the key properties of 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol?
2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol has a molecular weight of 253.43 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-6,6-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-ol is sourced from PubChem (CID 20501070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).