About 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid
7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid (PubChem CID 2050115) has the molecular formula C8H4BrN3O2
and a molecular weight of 254.04 g/mol. Its IUPAC name is 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid.
Molecular Properties
| Compound Name | 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid |
| PubChem CID | 2050115 |
| Molecular Formula | C8H4BrN3O2 |
| Molecular Weight | 254.04 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid |
| SMILES | O=C(O)c1nc2nccnc2cc1Br |
| InChI | InChI=1S/C8H4BrN3O2/c9-4-3-5-7(11-2-1-10-5)12-6(4)8(13)14/h1-3H,(H,13,14) |
| InChIKey | GHRJGGQQZPMOHM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.04 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid?
The IUPAC name of 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid (CID 2050115) is 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid.
What is the SMILES notation for 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid?
The canonical SMILES for 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid is O=C(O)c1nc2nccnc2cc1Br.
What is the InChIKey of 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid?
The InChIKey is GHRJGGQQZPMOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrN3O2/c9-4-3-5-7(11-2-1-10-5)12-6(4)8(13)14/h1-3H,(H,13,14).
What are the key properties of 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid?
7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid has a molecular weight of 254.04 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromopyrido[2,3-b]pyrazine-6-carboxylic acid is sourced from PubChem (CID 2050115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).