C14H24O — CID 20501703
(4E)-6-ethyl-4,6,8-trimethylnona-4,8-dien-3-one (PubChem CID 20501703) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (4E)-6-ethyl-4,6,8-trimethylnona-4,8-dien-3-one.
| Compound Name | (4E)-6-ethyl-4,6,8-trimethylnona-4,8-dien-3-one |
|---|---|
| PubChem CID | 20501703 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (4E)-6-ethyl-4,6,8-trimethylnona-4,8-dien-3-one |
| SMILES | C=C(C)CC(C)(/C=C(\C)C(=O)CC)CC |
| InChI | InChI=1S/C14H24O/c1-7-13(15)12(5)10-14(6,8-2)9-11(3)4/h10H,3,7-9H2,1-2,4-6H3/b12-10+ |
| InChIKey | DJKDMTBXQAXWLQ-ZRDIBKRKSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|