About (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one
(4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one (PubChem CID 20501704) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one.
Molecular Properties
| Compound Name | (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one |
| PubChem CID | 20501704 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one |
| SMILES | C=CC/C=C/C(C)(CC=C)C(C)=O |
| InChI | InChI=1S/C12H18O/c1-5-7-8-10-12(4,9-6-2)11(3)13/h5-6,8,10H,1-2,7,9H2,3-4H3/b10-8+ |
| InChIKey | IIKUPZJEHFMLNK-CSKARUKUSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one?
The IUPAC name of (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one (CID 20501704) is (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one.
What is the SMILES notation for (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one?
The canonical SMILES for (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one is C=CC/C=C/C(C)(CC=C)C(C)=O.
What is the InChIKey of (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one?
The InChIKey is IIKUPZJEHFMLNK-CSKARUKUSA-N. The full InChI is InChI=1S/C12H18O/c1-5-7-8-10-12(4,9-6-2)11(3)13/h5-6,8,10H,1-2,7,9H2,3-4H3/b10-8+.
What are the key properties of (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one?
(4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one has a molecular weight of 178.27 g/mol, XLogP of 3.29, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-methyl-3-prop-2-enylocta-4,7-dien-2-one is sourced from PubChem (CID 20501704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).