C10H16O — CID 20501818
(4E)-4-methylnona-4,8-dien-3-one (PubChem CID 20501818) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (4E)-4-methylnona-4,8-dien-3-one.
| Compound Name | (4E)-4-methylnona-4,8-dien-3-one |
|---|---|
| PubChem CID | 20501818 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (4E)-4-methylnona-4,8-dien-3-one |
| SMILES | C=CCC/C=C(\C)C(=O)CC |
| InChI | InChI=1S/C10H16O/c1-4-6-7-8-9(3)10(11)5-2/h4,8H,1,5-7H2,2-3H3/b9-8+ |
| InChIKey | YDSHVJZIMROKNP-CMDGGOBGSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|