About benzenesulfonate;2-sulfobutanedioate
benzenesulfonate;2-sulfobutanedioate (PubChem CID 20502016) has the molecular formula C10H9O10S2-3
and a molecular weight of 353.31 g/mol. Its IUPAC name is benzenesulfonate;2-sulfobutanedioate.
Molecular Properties
| Compound Name | benzenesulfonate;2-sulfobutanedioate |
| PubChem CID | 20502016 |
| Molecular Formula | C10H9O10S2-3 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | benzenesulfonate;2-sulfobutanedioate |
| SMILES | O=C([O-])CC(C(=O)[O-])S(=O)(=O)O.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H6O7S/c7-10(8,9)6-4-2-1-3-5-6;5-3(6)1-2(4(7)8)12(9,10)11/h1-5H,(H,7,8,9);2H,1H2,(H,5,6)(H,7,8)(H,9,10,11)/p-3 |
| InChIKey | XVDZCSSGGQCEPZ-UHFFFAOYSA-K |
| XLogP | -3.28 |
| TPSA | 191.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;2-sulfobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;2-sulfobutanedioate?
The IUPAC name of benzenesulfonate;2-sulfobutanedioate (CID 20502016) is benzenesulfonate;2-sulfobutanedioate.
What is the SMILES notation for benzenesulfonate;2-sulfobutanedioate?
The canonical SMILES for benzenesulfonate;2-sulfobutanedioate is O=C([O-])CC(C(=O)[O-])S(=O)(=O)O.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;2-sulfobutanedioate?
The InChIKey is XVDZCSSGGQCEPZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H6O3S.C4H6O7S/c7-10(8,9)6-4-2-1-3-5-6;5-3(6)1-2(4(7)8)12(9,10)11/h1-5H,(H,7,8,9);2H,1H2,(H,5,6)(H,7,8)(H,9,10,11)/p-3.
What are the key properties of benzenesulfonate;2-sulfobutanedioate?
benzenesulfonate;2-sulfobutanedioate has a molecular weight of 353.31 g/mol, XLogP of -3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;2-sulfobutanedioate is sourced from PubChem (CID 20502016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).