About 2,4-bis(2,4-dimethylheptan-2-yl)phenol
2,4-bis(2,4-dimethylheptan-2-yl)phenol (PubChem CID 20502107) has the molecular formula C24H42O
and a molecular weight of 346.60 g/mol. Its IUPAC name is 2,4-bis(2,4-dimethylheptan-2-yl)phenol.
Molecular Properties
| Compound Name | 2,4-bis(2,4-dimethylheptan-2-yl)phenol |
| PubChem CID | 20502107 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 2,4-bis(2,4-dimethylheptan-2-yl)phenol |
| SMILES | CCCC(C)CC(C)(C)c1ccc(O)c(C(C)(C)CC(C)CCC)c1 |
| InChI | InChI=1S/C24H42O/c1-9-11-18(3)16-23(5,6)20-13-14-22(25)21(15-20)24(7,8)17-19(4)12-10-2/h13-15,18-19,25H,9-12,16-17H2,1-8H3 |
| InChIKey | MOQHZGCCXNGUPE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-bis(2,4-dimethylheptan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(2,4-dimethylheptan-2-yl)phenol?
The IUPAC name of 2,4-bis(2,4-dimethylheptan-2-yl)phenol (CID 20502107) is 2,4-bis(2,4-dimethylheptan-2-yl)phenol.
What is the SMILES notation for 2,4-bis(2,4-dimethylheptan-2-yl)phenol?
The canonical SMILES for 2,4-bis(2,4-dimethylheptan-2-yl)phenol is CCCC(C)CC(C)(C)c1ccc(O)c(C(C)(C)CC(C)CCC)c1.
What is the InChIKey of 2,4-bis(2,4-dimethylheptan-2-yl)phenol?
The InChIKey is MOQHZGCCXNGUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O/c1-9-11-18(3)16-23(5,6)20-13-14-22(25)21(15-20)24(7,8)17-19(4)12-10-2/h13-15,18-19,25H,9-12,16-17H2,1-8H3.
What are the key properties of 2,4-bis(2,4-dimethylheptan-2-yl)phenol?
2,4-bis(2,4-dimethylheptan-2-yl)phenol has a molecular weight of 346.60 g/mol, XLogP of 7.60, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(2,4-dimethylheptan-2-yl)phenol is sourced from PubChem (CID 20502107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).