About ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate
ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate (PubChem CID 20502728) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate |
| PubChem CID | 20502728 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(N(C(=O)COC)c2c(CC)cccc2CC)CC1 |
| InChI | InChI=1S/C19H27NO4/c1-5-14-9-8-10-15(6-2)17(14)20(16(21)13-23-4)19(11-12-19)18(22)24-7-3/h8-10H,5-7,11-13H2,1-4H3 |
| InChIKey | LRGHNVOKJONIMV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate (CID 20502728) is ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate is CCOC(=O)C1(N(C(=O)COC)c2c(CC)cccc2CC)CC1.
What is the InChIKey of ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate?
The InChIKey is LRGHNVOKJONIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO4/c1-5-14-9-8-10-15(6-2)17(14)20(16(21)13-23-4)19(11-12-19)18(22)24-7-3/h8-10H,5-7,11-13H2,1-4H3.
What are the key properties of ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate?
ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate has a molecular weight of 333.43 g/mol, XLogP of 2.89, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,6-diethyl-N-(2-methoxyacetyl)anilino)cyclopropane-1-carboxylate is sourced from PubChem (CID 20502728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).