About 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate
1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate (PubChem CID 20502829) has the molecular formula C9H13ClO4
and a molecular weight of 220.65 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate |
| PubChem CID | 20502829 |
| Molecular Formula | C9H13ClO4 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate |
| SMILES | CCOC(=O)/C(CC)=C(\Cl)C(=O)OC |
| InChI | InChI=1S/C9H13ClO4/c1-4-6(8(11)14-5-2)7(10)9(12)13-3/h4-5H2,1-3H3/b7-6- |
| InChIKey | PSOGUFPMQXRXKB-SREVYHEPSA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate?
The IUPAC name of 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate (CID 20502829) is 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate.
What is the SMILES notation for 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate?
The canonical SMILES for 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate is CCOC(=O)/C(CC)=C(\Cl)C(=O)OC.
What is the InChIKey of 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate?
The InChIKey is PSOGUFPMQXRXKB-SREVYHEPSA-N. The full InChI is InChI=1S/C9H13ClO4/c1-4-6(8(11)14-5-2)7(10)9(12)13-3/h4-5H2,1-3H3/b7-6-.
What are the key properties of 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate?
1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate has a molecular weight of 220.65 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-methyl (Z)-3-chloro-2-ethylbut-2-enedioate is sourced from PubChem (CID 20502829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).